2,4,6-Tris(bromomethyl)mesitylene
- Product Name2,4,6-Tris(bromomethyl)mesitylene
- CAS21988-87-4
- MFC12H15Br3
- MW398.96
- EINECS244-697-1
- MOL File21988-87-4.mol
Chemical Properties
| Melting point | 187-189 °C (lit.) |
| Boiling point | 399.8±37.0 °C(Predicted) |
| Density | 1.759±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C12H15Br3/c1-7-10(4-13)8(2)12(6-15)9(3)11(7)5-14/h4-6H2,1-3H3 |
| InChIKey | BHIFXIATEXVOQA-UHFFFAOYSA-N |
| SMILES | C1(CBr)=C(C)C(CBr)=C(C)C(CBr)=C1C |
| CAS DataBase Reference | 21988-87-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 22-26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2903998090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |