Benzenesulfinic acid sodium salt dihydrate
- Product NameBenzenesulfinic acid sodium salt dihydrate
- CAS25932-11-0
- MFC6H9NaO4S
- MW200.19
- EINECS212-842-8
- MOL File25932-11-0.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | almost transparency |
| InChI | InChI=1S/C6H6O2S.Na/c7-9(8)6-4-2-1-3-5-6;/h1-5H,(H,7,8);/q;+1/p-1 |
| InChIKey | CHLCPTJLUJHDBO-UHFFFAOYSA-M |
| SMILES | C1(S([O-])=O)=CC=CC=C1.[Na+] |
| CAS DataBase Reference | 25932-11-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 1 |
| RTECS | DA9135000 |
| HS Code | 2930.90.2900 |