Tetramethylammonium nitrate
- Product NameTetramethylammonium nitrate
- CAS1941-24-8
- MFC4H12N2O3
- MW136.15
- EINECS217-723-4
- MOL File1941-24-8.mol
Chemical Properties
| Melting point | ≥300 °C(lit.) |
| Boiling point | 250.42°C (rough estimate) |
| Density | 1.2844 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Crystalline |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in water. |
| BRN | 3917260 |
| Stability | Stable. Reacts with rust, bases, copper, strong oxidizing agents, reducing agents. |
| InChI | 1S/C4H12N.NO3/c1-5(2,3)4;2-1(3)4/h1-4H3;/q+1;-1 |
| InChIKey | QGPVYHSXZFOSRL-UHFFFAOYSA-N |
| SMILES | [O-][N+]([O-])=O.C[N+](C)(C)C |
| CAS DataBase Reference | 1941-24-8(CAS DataBase Reference) |
| EPA Substance Registry System | Methanaminium, N,N,N-trimethyl-, nitrate (1941-24-8) |
Safety Information
| Hazard Codes | O,Xi |
| Risk Statements | 8-36/37/38 |
| Safety Statements | 17-26-36 |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 2 Skin Irrit. 2 STOT SE 3 |
