| Melting point |
148 °C |
| Boiling point |
465.3±45.0 °C(Predicted) |
| Density |
1.174±0.06 g/cm3(Predicted) |
| refractive index |
20.5 ° (C=1, EtOH) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
almost transparency in EtOH |
| form |
powder to crystal |
| pka |
3.54±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
Consistent with structure |
| BRN |
2000284 |
| Major Application |
peptide synthesis |
| InChI |
1S/C15H21NO5/c1-15(2,3)21-10-12(13(17)18)16-14(19)20-9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey |
TXDGEONUWGOCJG-LBPRGKRZSA-N |
| SMILES |
CC(C)(C)OC[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference |
1676-75-1(CAS DataBase Reference) |
