Ethyl thiooxamate
- Product NameEthyl thiooxamate
- CAS16982-21-1
- MFC4H7NO2S
- MW133.17
- EINECS
- MOL File16982-21-1.mol
Chemical Properties
| Melting point | 62-65 °C (lit.) |
| Boiling point | 199.2±23.0 °C(Predicted) |
| Density | 1.226 (estimate) |
| refractive index | 1.5480 (estimate) |
| Flash point | 74° |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | chloroform: soluble25mg/mL, clear to slightly hazy (colorless to orange) |
| form | Crystalline Powder |
| pka | 11.31±0.29(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C4H7NO2S/c1-2-7-4(6)3(5)8/h2H2,1H3,(H2,5,8) |
| InChIKey | YMBMCMOZIGSBOA-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(N)=S |
| CAS DataBase Reference | 16982-21-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NA1993 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |