2-Chloro-4-fluoroaniline
- Product Name2-Chloro-4-fluoroaniline
- CAS2106-02-7
- MFC6H5ClFN
- MW145.56
- EINECS218-282-0
- MOL File2106-02-7.mol
Chemical Properties
| Boiling point | 192 °C (lit.) |
| Density | 1.219 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 209 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.71±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.3111.219 |
| BRN | 2802559 |
| InChI | InChI=1S/C6H5ClFN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2 |
| InChIKey | XRAKCYJTJGTSMM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 2106-02-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 2-chloro-4-fluoro- (2106-02-7) |
Safety Information
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39-36-24/25 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
