2-Chloro-4-fluoroaniline
- Product Name2-Chloro-4-fluoroaniline
- CAS2106-02-7
- CBNumberCB0119090
- MFC6H5ClFN
- MW145.56
- EINECS218-282-0
- MDL NumberMFCD00042530
- MOL File2106-02-7.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 192 °C (lit.) |
| Density | 1.219 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 209 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.71±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.3111.219 |
| BRN | 2802559 |
| InChI | InChI=1S/C6H5ClFN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2 |
| InChIKey | XRAKCYJTJGTSMM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 2106-02-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 2-chloro-4-fluoro- (2106-02-7) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H311-H332-H373-H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P305+P351+P338-P264-P270-P271-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P280h-P301+P312-P302+P352-P314-P501a | |||||||||
| Hazard Codes | Xn,T,Xi | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-37/39-36/37/39-36-24/25 | |||||||||
| RIDADR | 2810 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Toxic | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29214200 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
