| Melting point |
253-255°C |
| Boiling point |
449.1±14.0 °C(Predicted) |
| Density |
1.359±0.06 g/cm3(Predicted) |
| storage temp. |
-20°C |
| solubility |
Soluble in DMSO (up to 25 mg/ml) or in Ethanol (up to 20 mg/ml). |
| pka |
9.22±0.10(Predicted) |
| form |
Powder |
| color |
Off-white |
| biological source |
plant root (bushy knotweed) |
| Water Solubility |
Soluble in water (3 mg/100mL), ethanol (50 mg/mL), DMSO (16 mg/mL), DMF (~65 mg/mL), PBS (pH 7.2) (~100µg/mL), methanol, and acetone (50 mg/mL). |
| Merck |
14,8158 |
| Henry's Law Constant |
7.0×1010 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable for 2 years as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 1 month. |
| Cosmetics Ingredients Functions |
SKIN PROTECTING
ANTIOXIDANT |
| InChI |
InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+ |
| InChIKey |
LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
| SMILES |
C1(O)=CC(/C=C/C2=CC=C(O)C=C2)=CC(O)=C1 |
| LogP |
3.139 (est) |
| CAS DataBase Reference |
501-36-0(CAS DataBase Reference) |
| EPA Substance Registry System |
1,3-Benzenediol, 5-[(1E)-2-(4-hydroxyphenyl)ethenyl]- (501-36-0) |
