| Melting point |
170-172°C |
| Boiling point |
128-129°C 10mm |
| Density |
0.869 g/mL at 25 °C(lit.) |
| FEMA |
3422 | 2,4-UNDECADIENAL |
| refractive index |
n20/D 1.514(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility |
DMSO, Methanol |
| form |
Solid |
| color |
White to Off-White |
| Odor |
at 1.00 % in dipropylene glycol. oily caramellic spicy citrus buttery baked |
| Odor Type |
green |
| biological source |
synthetic |
| Sensitive |
Air Sensitive |
| BRN |
1706330 |
| Major Application |
flavors and fragrances |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C11H18O/c1-2-3-4-5-6-7-8-9-10-11-12/h7-11H,2-6H2,1H3/b8-7+,10-9+ |
| InChIKey |
UVIUIIFPIWRILL-XBLVEGMJSA-N |
| SMILES |
[H]C(=O)\C([H])=C([H])\C([H])=C(/[H])CCCCCC |
| LogP |
3.71 |
| CAS DataBase Reference |
30361-29-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
2,4-Undecadienal, (e,e)-(30361-29-6) |
| EPA Substance Registry System |
2,4-Undecadienal, (2E,4E)- (30361-29-6) |
