(R)-1-Boc-3-Aminopiperidine
- Product Name(R)-1-Boc-3-Aminopiperidine
- CAS188111-79-7
- CBNumberCB7326716
- MFC10H20N2O2
- MW200.28
- EINECS628-472-9
- MDL NumberMFCD03094717
- MOL File188111-79-7.mol
- MSDS FileSDS
Chemical Properties
| alpha | 28.5 º (c=1, DMF) |
| Boiling point | 277.3±33.0 °C(Predicted) |
| Density | 1.041±0.06 g/cm3(Predicted) |
| refractive index | 1.4730 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), DMF (Slightly), DMSO (Slightly) |
| pka | 10.35±0.20(Predicted) |
| form | Liquid |
| color | Colorless to pale yellow |
| optical activity | [α]/D -28.5±2°, c = 1 in DMF |
| Water Solubility | Immiscible with water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7,11H2,1-3H3/t8-/m1/s1 |
| InChIKey | AKQXKEBCONUWCL-MRVPVSSYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H](N)C1 |
| CAS DataBase Reference | 188111-79-7(CAS DataBase Reference) |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| RIDADR | UN2735 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-34 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29333990 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
