
188111-79-7
| Name | (R)-1-Boc-3-Aminopiperidine |
| CAS | 188111-79-7 |
| EINECS(EC#) | 628-472-9 |
| Molecular Formula | C10H20N2O2 |
| MDL Number | MFCD04973125 |
| Molecular Weight | 200.28 |
| MOL File | 188111-79-7.mol |
Chemical Properties
| alpha | 28.5 º (c=1, DMF) |
| Boiling point | 277.3±33.0 °C(Predicted) |
| density | 1.041±0.06 g/cm3(Predicted) |
| refractive index | 1.4730 |
| storage temp. | Store under inert gas |
| solubility | Chloroform (Slightly), DMF (Slightly), DMSO (Slightly) |
| form | Liquid |
| pka | 10.35±0.20(Predicted) |
| color | Colorless to pale yellow |
| Optical Rotation | [α]/D -28.5±2°, c = 1 in DMF |
| Water Solubility | Immiscible with water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7,11H2,1-3H3/t8-/m1/s1 |
| InChIKey | AKQXKEBCONUWCL-MRVPVSSYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H](N)C1 |
| CAS DataBase Reference | 188111-79-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2735 |
| WGK Germany | 3 |
| F | 10-34 |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
