
87120-72-7
| Name | 4-Amino-1-Boc-piperidine |
| CAS | 87120-72-7 |
| EINECS(EC#) | 1312995-182-4 |
| Molecular Formula | C10H20N2O2 |
| MDL Number | MFCD01076201 |
| Molecular Weight | 200.28 |
| MOL File | 87120-72-7.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 50°C |
| Boiling point | 80/0.037mm |
| density | 1.041±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder, Crystals and/or Chunks |
| pka | 10.10±0.20(Predicted) |
| color | White to pale yellow to beige |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| Detection Methods | GC |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-8(11)5-7-12/h8H,4-7,11H2,1-3H3 |
| InChIKey | LZRDHSFPLUWYAX-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(N)CC1 |
| CAS DataBase Reference | 87120-72-7(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3259 |
| WGK Germany | 2 |
| F | 10-34 |
| Hazard Note | Irritant |
| TSCA | N |
| HazardClass | 8 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

