Zinc methacrylate
- Product NameZinc methacrylate
- CAS13189-00-9
- CBNumberCB6178301
- MFC8H10O4Zn
- MW235.55
- EINECS236-144-8
- MDL NumberMFCD00045887
- MOL File13189-00-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 229-232 °C(lit.) |
| Density | 1,4 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| Specific Gravity | 1.48 |
| Appearance | White to off-white Solid |
| Water Solubility | 100mg/L at 20℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/2C4H6O2.Zn/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | PIMBTRGLTHJJRV-UHFFFAOYSA-L |
| SMILES | C(=O)(O[Zn]OC(=O)C(=C)C)C(=C)C |
| LogP | 0.3 at 25℃ |
| CAS DataBase Reference | 13189-00-9(CAS DataBase Reference) |
| EPA Substance Registry System | Zinc dimethacrylate (13189-00-9) |
| UNSPSC Code | 12352302 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Danger |
| Hazard statements | H315-H319-H334-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 STOT SE 3 |
