1H,1H,7H-Dodecafluoroheptyl methacrylate
- Product Name1H,1H,7H-Dodecafluoroheptyl methacrylate
- CAS2261-99-6
- CBNumberCB0233194
- MFC11H8F12O2
- MW400.16
- EINECS218-863-9
- MDL NumberMFCD00080658
- MOL File2261-99-6.mol
Chemical Properties
| Boiling point | 112 °C |
| Density | 1.536 |
| refractive index | 1.349 |
| Flash point | 104 |
| storage temp. | Keep Cold |
| form | clear liquid |
| Specific Gravity | 1.536 |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C11H8F12O2/c1-4(2)5(24)25-3-7(14,15)9(18,19)11(22,23)10(20,21)8(16,17)6(12)13/h6H,1,3H2,2H3 |
| InChIKey | YJKHMSPWWGBKTN-UHFFFAOYSA-N |
| SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)(=O)C(C)=C |
| CAS DataBase Reference | 2261-99-6(CAS DataBase Reference) |
| EPA Substance Registry System | (6H-Perfluorohexyl)methyl methacrylate (2261-99-6) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319 | |||||||||
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 | |||||||||
| Hazard Codes | F,Xi | |||||||||
| Risk Statements | 36/37/38-23/24/25 | |||||||||
| Safety Statements | 26-36/37/39-28 | |||||||||
| RIDADR | 2810 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29161400 | |||||||||
| NFPA 704: |
|
