13189-00-9
| Name | Zinc methacrylate |
| CAS | 13189-00-9 |
| EINECS(EC#) | 236-144-8 |
| Molecular Formula | C8H10O4Zn |
| MDL Number | MFCD00045887 |
| Molecular Weight | 235.55 |
| MOL File | 13189-00-9.mol |
Chemical Properties
| Melting point | 229-232 °C(lit.) |
| density | 1,4 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| Specific Gravity | 1.48 |
| Appearance | White to off-white Solid |
| Water Solubility | 100mg/L at 20℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/2C4H6O2.Zn/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | PIMBTRGLTHJJRV-UHFFFAOYSA-L |
| SMILES | C(=O)(O[Zn]OC(=O)C(=C)C)C(=C)C |
| LogP | 0.3 at 25℃ |
| CAS DataBase Reference | 13189-00-9(CAS DataBase Reference) |
| EPA Substance Registry System | 13189-00-9(EPA Substance) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 STOT SE 3 |