Fenbufen
- Product NameFenbufen
- CAS36330-85-5
- CBNumberCB2239125
- MFC16H14O3
- MW254.29
- EINECS252-979-0
- MDL NumberMFCD00056701
- MOL File36330-85-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 184-187 °C (lit.) |
| Boiling point | 357.5°C (rough estimate) |
| Density | 1.1565 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | 2-8°C |
| solubility | Very slightly soluble in water, slightly soluble in acetone, in ethanol (96 per cent) and in methylene chloride. |
| form | Solid |
| pka | pKa 4.3(H2O tundened Iundened) (Uncertain) |
| color | White to off-white |
| Water Solubility | 2.212mg/L(25 ºC) |
| Merck | 13,3990 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C16H14O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19) |
| InChIKey | ZPAKPRAICRBAOD-UHFFFAOYSA-N |
| SMILES | OC(=O)CCC(=O)c1ccc(cc1)-c2ccccc2 |
| FDA UNII | 9815R1WR9B |
| ATC code | M01AE05 |
| EPA Substance Registry System | [1,1'-Biphenyl]-4-butanoic acid, .gamma.-oxo- (36330-85-5) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301 | |||||||||
| Precautionary statements | P301+P310+P330 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 25 | |||||||||
| Safety Statements | 28-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | DV1761000 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2918300090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral | |||||||||
| Toxicity | LD50 in various strains of mice, rats (mg/kg): 795-1673, 200-720 orally; 506-811, 265-575 i.p. (Bolte) | |||||||||
| NFPA 704: |
|
