| Melting point |
184-187 °C (lit.) |
| Boiling point |
357.5°C (rough estimate) |
| Density |
1.1565 (rough estimate) |
| refractive index |
1.5600 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Very slightly soluble in water, slightly soluble in acetone, in ethanol (96 per cent) and in methylene chloride. |
| pka |
pKa 4.3(H2O tunde?ned Iunde?ned) (Uncertain) |
| form |
Solid |
| color |
White to off-white |
| Water Solubility |
2.212mg/L(25 ºC) |
| Merck |
13,3990 |
| Major Application |
forensics and toxicology
pharmaceutical (small molecule)
veterinary |
| InChI |
1S/C16H14O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19) |
| InChIKey |
ZPAKPRAICRBAOD-UHFFFAOYSA-N |
| SMILES |
OC(=O)CCC(=O)c1ccc(cc1)-c2ccccc2 |
| EPA Substance Registry System |
[1,1'-Biphenyl]-4-butanoic acid, .gamma.-oxo- (36330-85-5) |
