36330-85-5
| Name | Fenbufen |
| CAS | 36330-85-5 |
| EINECS(EC#) | 252-979-0 |
| Molecular Formula | C16H14O3 |
| MDL Number | MFCD00056701 |
| Molecular Weight | 254.28 |
| MOL File | 36330-85-5.mol |
Chemical Properties
| Appearance | White Solid |
| Melting point | 184-187 °C(lit.) |
| Boiling point | 357.5°C (rough estimate) |
| density | 1.1565 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | Refrigerator |
| solubility | Very slightly soluble in water, slightly soluble in acetone, in ethanol (96 per cent) and in methylene chloride. |
| form | neat |
| pka | pKa 4.3(H2O tunde?ned Iunde?ned) (Uncertain) |
| color | White to off-white |
| Water Solubility | 2.212mg/L(25 ºC) |
| Merck | 13,3990 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C16H14O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19) |
| InChIKey | ZPAKPRAICRBAOD-UHFFFAOYSA-N |
| SMILES | OC(=O)CCC(=O)c1ccc(cc1)-c2ccccc2 |
| EPA Substance Registry System | [1,1'-Biphenyl]-4-butanoic acid, .gamma.-oxo- (36330-85-5) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310+P330 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DV1761000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2918300090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity |