2,2,4,4,6,6-Hexamethylcyclotrisilazane
- Product Name2,2,4,4,6,6-Hexamethylcyclotrisilazane
- CAS1009-93-4
- CBNumberCB1724802
- MFC6H21N3Si3
- MW219.51
- EINECS213-773-6
- MDL NumberMFCD00039698
- MOL File1009-93-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | −10 °C(lit.) |
| Boiling point | 188 °C756 mm Hg(lit.) |
| Density | 0.92 g/mL at 25 °C(lit.) |
| vapor pressure | 35Pa at 25℃ |
| refractive index | n |
| Flash point | 139 °F |
| storage temp. | 2-8°C, protect from light |
| Water Solubility | Decomposes in contact with water,Insoluble in water |
| form | liquid |
| pka | 14.76±0.20(Predicted) |
| color | colorless |
| Specific Gravity | 0.922 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 774739 |
| InChI | 1S/C6H21N3Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h7-9H,1-6H3 |
| InChIKey | WGGNJZRNHUJNEM-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)N[Si](C)(C)N[Si](C)(C)N1 |
| CAS DataBase Reference | 1009-93-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H302-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P233-P240-P301+P312+P330-P302+P352-P305+P351+P338-P301+P312-P303+P361+P353 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | 1993 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | GZ4720000 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3.2 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29349990 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
