1009-93-4
| Name | 2,2,4,4,6,6-Hexamethylcyclotrisilazane |
| CAS | 1009-93-4 |
| EINECS(EC#) | 213-773-6 |
| Molecular Formula | C6H24N3Si3 |
| MDL Number | MFCD00039698 |
| Molecular Weight | 222.53 |
| MOL File | 1009-93-4.mol |
Chemical Properties
| Appearance | clear colorless liquid |
| Melting point | −10 °C(lit.) |
| Boiling point | 188 °C756 mm Hg(lit.) |
| density | 0.92 g/mL at 25 °C(lit.) |
| vapor pressure | 35Pa at 25℃ |
| refractive index | n |
| Fp | 139 °F |
| storage temp. | 2-8°C, protect from light |
| Water Solubility | Decomposes in contact with water,Insoluble in water |
| form | liquid |
| pka | 14.76±0.20(Predicted) |
| color | colorless |
| Specific Gravity | 0.922 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 774739 |
| InChI | 1S/C6H21N3Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h7-9H,1-6H3 |
| InChIKey | WGGNJZRNHUJNEM-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)N[Si](C)(C)N[Si](C)(C)N1 |
| CAS DataBase Reference | 1009-93-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07,GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302-H315-H319-H335-H226-H302-H315-H319-H335 |
| Precautionary statements | P210-P210-P233-P240-P301+P312+P330-P302+P352-P305+P351+P338-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1993 |
| WGK Germany | 3 |
| RTECS | GZ4720000 |
| F | 10-21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |