
1070-89-9
| Name | Sodium bis(trimethylsilyl)amide |
| CAS | 1070-89-9 |
| EINECS(EC#) | 213-983-8 |
| Molecular Formula | C6H18NNaSi2 |
| MDL Number | MFCD00009835 |
| Molecular Weight | 183.37 |
| MOL File | 1070-89-9.mol |
Chemical Properties
| Appearance | Slightly yellow to light beige crystalline powder |
| Melting point | 171-175 °C (lit.) |
| Boiling point | 67°C |
| density | 0.904 g/mL at 25 °C |
| Fp | 43 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in hexane, toluene, ether,terahydrofuran, benzene and toluene. |
| form | Liquid |
| color | Clear orange to brown |
| Specific Gravity | 0.9 |
| Water Solubility | reacts |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| Detection Methods | TITR,T |
| BRN | 3629917 |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | 1S/C6H18NSi2.Na/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1 |
| InChIKey | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N([Na])[Si](C)(C)C |
Safety Data
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 4.3 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
