
15933-59-2
| Name | 1,1,3,3-TETRAMETHYLDISILAZANE |
| CAS | 15933-59-2 |
| EINECS(EC#) | 240-072-2 |
| Molecular Formula | C4H15NSi2 |
| MDL Number | MFCD00025626 |
| Molecular Weight | 133.34 |
| MOL File | 15933-59-2.mol |
Chemical Properties
| Appearance | Clear colorless to faintly yellow liquid |
| Melting point | 99-100 °C |
| Boiling point | 99-100 °C |
| density | 0.752 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 17 °F |
| storage temp. | Store below +30°C. |
| solubility | Miscible with common organic solvents. |
| form | clear liquid |
| pka | 9.80±0.70(Predicted) |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.752 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 741869 |
| InChI | 1S/C4H15NSi2/c1-6(2)5-7(3)4/h5-7H,1-4H3 |
| InChIKey | NQCZAYQXPJEPDS-UHFFFAOYSA-N |
| SMILES | [H][Si](C)(C)N[Si]([H])(C)C |
| CAS DataBase Reference | 15933-59-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |

