77811-44-0
| Name | 4-Bromo-2-methyl-6-nitroaniline |
| CAS | 77811-44-0 |
| EINECS(EC#) | 615-013-2 |
| Molecular Formula | C7H7BrN2O2 |
| MDL Number | MFCD00052919 |
| Molecular Weight | 231.05 |
| MOL File | 77811-44-0.mol |
Chemical Properties
| Appearance | orange to orange-brown glistening crystals |
| Melting point | 143-147 °C |
| Boiling point | 326.8±37.0 °C(Predicted) |
| density | 1.7207 (rough estimate) |
| refractive index | 1.5150 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | -1.23±0.25(Predicted) |
| color | Light yellow to Brown |
| Water Solubility | Slightly soluble in water and soluble in hot methanol. |
| BRN | 3530524 |
| InChI | InChI=1S/C7H7BrN2O2/c1-4-2-5(8)3-6(7(4)9)10(11)12/h2-3H,9H2,1H3 |
| InChIKey | ZXFVKFUXKFPUQJ-UHFFFAOYSA-N |
| SMILES | C1(N)=C([N+]([O-])=O)C=C(Br)C=C1C |
| CAS DataBase Reference | 77811-44-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H301-H311-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P264-P270-P271-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P280h-P301+P310a-P304+P340-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |