6342-17-2
| Name | 1,4-Diacryloylpiperazine |
| CAS | 6342-17-2 |
| EINECS(EC#) | 613-215-5 |
| Molecular Formula | C10H14N2O2 |
| MDL Number | MFCD00077661 |
| Molecular Weight | 194.23 |
| MOL File | 6342-17-2.mol |
Chemical Properties
| Melting point | 91.5-93.5 °C(lit.) |
| Boiling point | 434.1±25.0 °C(Predicted) |
| density | 1.114±0.06 g/cm3(Predicted) |
| RTECS | UD6715000 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder |
| pka | -0.70±0.70(Predicted) |
| color | White to off-white |
| Usage | Used as a crosslinker in polyacrylamide gels. PIP provides polyacrylamide gels with increased physical strength and improved separation and detection of proteins |
| Detection Methods | HPLC,NMR |
| BRN | 745431 |
| InChI | InChI=1S/C10H14N2O2/c1-3-9(13)11-5-7-12(8-6-11)10(14)4-2/h3-4H,1-2,5-8H2 |
| InChIKey | YERHJBPPDGHCRJ-UHFFFAOYSA-N |
| SMILES | N1(C(=O)C=C)CCN(C(=O)C=C)CC1 |
| CAS DataBase Reference | 6342-17-2(CAS DataBase Reference) |
| Storage Precautions | Moisture sensitive |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 8 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |