886-38-4
| Name | DIPHENYLCYCLOPROPENONE |
| CAS | 886-38-4 |
| EINECS(EC#) | 212-948-4 |
| Molecular Formula | C15H10O |
| MDL Number | MFCD00001311 |
| Molecular Weight | 206.24 |
| MOL File | 886-38-4.mol |
Chemical Properties
| Appearance | slightly pinkish-orange to beige crystalline |
| Melting point | 118-122 °C(lit.) |
| Boiling point | 305.09°C (rough estimate) |
| density | 1.232 |
| refractive index | 1.6324 (estimate) |
| storage temp. | Refrigerator (+4°C) |
| solubility | DMF:20.0(Max Conc. mg/mL);96.97(Max Conc. mM) DMSO:20.0(Max Conc. mg/mL);96.97(Max Conc. mM) DMSO:PBS (pH 7.2) (1:1):0.5(Max Conc. mg/mL);2.42(Max Conc. mM) Ethanol:14.0(Max Conc. mg/mL);67.88(Max Conc. mM) |
| form | Crystalline Powder |
| color | Slightly pinkish-orange to beige |
| Merck | 14,3308 |
| BRN | 608049 |
| InChI | InChI=1S/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| Contact allergens | |
| InChIKey | HCIBTBXNLVOFER-UHFFFAOYSA-N |
| SMILES | C1(=O)C(C2=CC=CC=C2)=C1C1=CC=CC=C1 |
| LogP | 1.769 (est) |
| CAS DataBase Reference | 886-38-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29142990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |