5909-24-0
| Name | Ethyl 4-chloro-2-methylthio-5-pyrimidinecarboxylate |
| CAS | 5909-24-0 |
| EINECS(EC#) | 227-619-0 |
| Molecular Formula | C8H9ClN2O2S |
| MDL Number | MFCD00006085 |
| Molecular Weight | 232.69 |
| MOL File | 5909-24-0.mol |
Chemical Properties
| Appearance | off white to light yellow solid |
| Melting point | 60-63 °C (lit.) |
| Boiling point | 132°C/0.4mmHg(lit.) |
| density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | Keep Cold |
| solubility | Chloroform, Ethyl Acetate |
| form | Crystalline Powder |
| pka | -2.19±0.29(Predicted) |
| color | White to light yellow to beige |
| Usage | A pyrimidine derivative as inhibitor of Streptococcus faecium, Lactobacillus casei, and Pediococcus cerevisiae |
| Detection Methods | GC,NMR |
| InChI | InChI=1S/C8H9ClN2O2S/c1-3-13-7(12)5-4-10-8(14-2)11-6(5)9/h4H,3H2,1-2H3 |
| InChIKey | SNNHLSHDDGJVDM-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC=C(C(OCC)=O)C(Cl)=N1 |
| CAS DataBase Reference | 5909-24-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29335900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
