5418-51-9
| Name | 2-Hydroxy-5-nitropyridine |
| CAS | 5418-51-9 |
| EINECS(EC#) | 226-525-7 |
| Molecular Formula | C5H4N2O3 |
| MDL Number | MFCD00006276 |
| Molecular Weight | 140.1 |
| MOL File | 5418-51-9.mol |
Chemical Properties
| Appearance | light yellow to beige crystalline powder |
| Melting point | 188-191 °C (lit.) |
| Boiling point | 256.56°C (rough estimate) |
| density | 1.5657 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| form | Crystalline Powder |
| pka | 8.06±0.10(Predicted) |
| color | Light yellow to beige |
| Water Solubility | Soluble in hot water and alkali liquor, Insoluble in most of organic solvents. |
| Detection Methods | HPLC,NMR |
| BRN | 120352 |
| InChI | InChI=1S/C5H4N2O3/c8-5-2-1-4(3-6-5)7(9)10/h1-3H,(H,6,8) |
| InChIKey | XKWSQIMYNVLGBO-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 5418-51-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Hydroxy-5-nitropyridine(5418-51-9) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
