3279-76-3
| Name | 2-Hydroxy-6-methylpyridine |
| CAS | 3279-76-3 |
| EINECS(EC#) | 221-919-5 |
| Molecular Formula | C6H7NO |
| MDL Number | MFCD00456278 |
| Molecular Weight | 109.13 |
| MOL File | 3279-76-3.mol |
Chemical Properties
| Appearance | white to cream-colored crystalline powder |
| Melting point | 157-159 °C (lit.) |
| Boiling point | 131-133C |
| density | 1.1143 (rough estimate) |
| refractive index | 1.5040 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 12.12±0.10(Predicted) |
| color | White to cream |
| BRN | 107073 |
| InChI | InChI=1S/C6H7NO/c1-5-3-2-4-6(8)7-5/h2-4H,1H3,(H,7,8) |
| InChIKey | JEAVIRYCMBDJIU-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)=CC=C1 |
| CAS DataBase Reference | 3279-76-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2(1H)-Pyridinone, 6-methyl-(3279-76-3) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |