54-12-6
| Name | DL-Tryptophan |
| CAS | 54-12-6 |
| EINECS(EC#) | 200-194-9 |
| Molecular Formula | C11H12N2O2 |
| MDL Number | MFCD04118170 |
| Molecular Weight | 204.23 |
| MOL File | 54-12-6.mol |
Chemical Properties
| Appearance | White crystals. Slightly soluble in water; stable in alkaline solution; decomposed by strong acids. |
| Melting point | 289-290 °C (dec.)(lit.) |
| alpha | [α]D20 -1～1°(c=1, dil. HCl) |
| Boiling point | 342.72°C (rough estimate) |
| density | 1.1754 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Store at RT. |
| solubility | methanol: water (7:3): soluble |
| form | Powder |
| pka | 2.30±0.10(Predicted) |
| color | White to light beige or light yellow |
| Odor | Odorless |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| Water Solubility | 10 g/L (20 ºC) |
| BRN | 86196 |
| Cosmetics Ingredients Functions | ANTISTATIC HAIR CONDITIONING FRAGRANCE |
| InChI | 1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
| InChIKey | QIVBCDIJIAJPQS-UHFFFAOYSA-N |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(O)=O |