
5350-41-4
| Name | Benzyltrimethylammonium bromide |
| CAS | 5350-41-4 |
| EINECS(EC#) | 226-320-2 |
| Molecular Formula | C10H16BrN |
| MDL Number | MFCD00011780 |
| Molecular Weight | 230.14 |
| MOL File | 5350-41-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 230-232 °C (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| form | Crystalline Powder |
| color | White to off-white |
| Sensitive | Hygroscopic |
| BRN | 3917251 |
| InChI | InChI=1S/C10H16N.BrH/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UUZYBYIOAZTMGC-UHFFFAOYSA-M |
| SMILES | C1(=CC=CC=C1)C[N+](C)(C)C.[Br-] |
| CAS DataBase Reference | 5350-41-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzyltrimethylammonium bromide(5350-41-4) |