
111865-47-5
| Name | Benzyltrimethylammonium tribromide |
| CAS | 111865-47-5 |
| Molecular Formula | C10H16Br3N |
| MDL Number | MFCD00134423 |
| Molecular Weight | 389.95 |
| MOL File | 111865-47-5.mol |
Chemical Properties
| Appearance | Yellow to orange crystalline powder |
| Melting point | 99-101 °C (lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | Yellow to orange |
| Sensitive | Hygroscopic |
| BRN | 7105839 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C10H16N.Br3/c1-11(2,3)9-10-7-5-4-6-8-10;1-3-2/h4-8H,9H2,1-3H3;/q+1;-1 |
| InChIKey | UZUKVMLVILGNPX-UHFFFAOYSA-K |
| SMILES | [Br-](Br)Br.C(C1C=CC=CC=1)[N+](C)(C)C |
| CAS DataBase Reference | 111865-47-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |


