3084-53-5
| Name | Trimethylsulfonium bromide |
| CAS | 3084-53-5 |
| EINECS(EC#) | 227-875-3 |
| Molecular Formula | C3H9BrS |
| MDL Number | MFCD00051367 |
| Molecular Weight | 157.07 |
| MOL File | 3084-53-5.mol |
Chemical Properties
| Melting point | 203°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | very faint turbidity |
| BRN | 3556022 |
| InChI | InChI=1S/C3H9S.BrH/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| InChIKey | GOTIICCWNAPLMN-UHFFFAOYSA-M |
| SMILES | C[S+](C)C.[Br-] |
| CAS DataBase Reference | 3084-53-5(CAS DataBase Reference) |
| EPA Substance Registry System | 3084-53-5(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |