5281-04-9
| Name | Pigment Red 57:1 |
| CAS | 5281-04-9 |
| EINECS(EC#) | 226-109-5 |
| Molecular Formula | C18H12N2Na2O6S |
| MDL Number | MFCD00059529 |
| Molecular Weight | 430.34 |
| MOL File | 5281-04-9.mol |
Chemical Properties
| density | 0.352-1.7[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| Colour Index | 15850 |
| form | powder to crystal |
| color | Red to Dark red to Brown |
| Water Solubility | 8.9mg/L at 25℃ |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChI | 1S/C18H14N2O6S.Ca/c1-10-6-7-14(15(8-10)27(24,25)26)19-20-16-12-5-3-2-4-11(12)9-13(17(16)21)18(22)23;/h2-9,19H,1H3,(H,22,23)(H,24,25,26);/q;+2/p-2/b20-16-; |
| InChIKey | WANIKCLUTOABTP-LRZQPWDCSA-L |
| SMILES | [Ca++].Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C([O-])=O)c(c1)S([O-])(=O)=O |
| LogP | 0.65-2.4 at 23-25℃ |
| CAS DataBase Reference | 5281-04-9(CAS DataBase Reference) |
| EPA Substance Registry System | 5281-04-9(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352+P333+P313+P363-P501 |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 1 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 3204170000 |
| Storage Class | 11 - Combustible Solids |