
1972-28-7
| Name | Diethyl azodicarboxylate |
| CAS | 1972-28-7 |
| EINECS(EC#) | 217-821-7 |
| Molecular Formula | C6H10N2O4 |
| MDL Number | MFCD00009103 |
| Molecular Weight | 174.15 |
| MOL File | 1972-28-7.mol |
Chemical Properties
| Appearance | Clear orange to orange-red liquid |
| Melting point | 6°C |
| Boiling point | 106°C (13 mmHg) |
| density | 1.106 |
| refractive index | n |
| Fp | 85°C |
| storage temp. | 2-8°C |
| solubility | Miscible with dichloromethane, diethyl ether and toluene. |
| form | liquid |
| color | Clear, orange |
| Stability: | Stable, but may explode if heated under confinement. May be shock sensitive. Decomposes vigorously if heated above 100 C. Incompatible with strong acids, strong bases, strong oxidizing agents, strong reducing agents. Light sensitive. |
| Sensitive | Air Sensitive |
| Detection Methods | GC,NMR |
| BRN | 908662 |
| InChI | InChI=1S/C6H10N2O4/c1-3-11-5(9)7-8-6(10)12-4-2/h3-4H2,1-2H3 |
| InChIKey | FAMRKDQNMBBFBR-FPLPWBNLSA-N |
| SMILES | N(C(OCC)=O)=NC(OCC)=O |
| CAS DataBase Reference | 1972-28-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Diethyl azo diformate(1972-28-7) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H242-H304-H315-H319-H335-H336-H361d-H373-H412 |
| Precautionary statements | P210-P301+P310-P331-P370+P378-P403+P233-P403+P235 |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3233 4.1 |
| WGK Germany | 3 |
| F | 9 |
| Hazard Note | Toxic/Irritant/Flammable |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29270000 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Eye Irrit. 2 Flam. Liq. 3 Repr. 2 Self-react. C Skin Irrit. 2 STOT RE 2 STOT SE 3 |


