
10497-05-9
| Name | TRIS(TRIMETHYLSILYL) PHOSPHATE |
| CAS | 10497-05-9 |
| EINECS(EC#) | 234-028-1 |
| Molecular Formula | C9H27O4PSi3 |
| MDL Number | MFCD00008267 |
| Molecular Weight | 314.54 |
| MOL File | 10497-05-9.mol |
Chemical Properties
| Melting point | 3-4 °C (lit.) |
| Boiling point | 228-229 °C/720 mmHg (lit.) |
| density | 0.945 g/mL at 25 °C(lit.) |
| vapor pressure | 23.3hPa at 20℃ |
| refractive index | n |
| Fp | 76 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | liquid |
| pka | 23-25(at 25℃) |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 0.959 |
| Water Solubility | 935.5μg/L at 20℃ |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1794624 |
| InChI | 1S/C9H27O4PSi3/c1-15(2,3)11-14(10,12-16(4,5)6)13-17(7,8)9/h1-9H3 |
| InChIKey | QJMMCGKXBZVAEI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| LogP | 4.72 at 20℃ |
| CAS DataBase Reference | 10497-05-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 2 |
| RTECS | TC9700000 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 2931.90.9010 |
| REACH Registrations | Active |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |

