2449-05-0
| Name | Dibenzyl azodicarboxylate |
| CAS | 2449-05-0 |
| EINECS(EC#) | 219-508-0 |
| Molecular Formula | C16H14N2O4 |
| MDL Number | MFCD00016737 |
| Molecular Weight | 298.29 |
| MOL File | 2449-05-0.mol |
Chemical Properties
| Appearance | yellow to orange crystalline powder |
| Melting point | 43-47 °C (lit.) |
| Boiling point | 439.72°C (rough estimate) |
| density | 1.2028 (rough estimate) |
| refractive index | 1.6240 (estimate) |
| Fp | >230 °F |
| storage temp. | 0-6°C |
| form | Crystalline Powder |
| color | Yellow to orange |
| Sensitive | Light Sensitive |
| BRN | 2298734 |
| InChI | InChI=1S/C16H14N2O4/c19-15(21-11-13-7-3-1-4-8-13)17-18-16(20)22-12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | IRJKSAIGIYODAN-ISLYRVAYSA-N |
| SMILES | N(C(OCC1=CC=CC=C1)=O)=NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 2449-05-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2449-05-0(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3224 |
| WGK Germany | 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
