
2446-83-5
| Name | Diisopropyl azodicarboxylate |
| CAS | 2446-83-5 |
| EINECS(EC#) | 219-502-8 |
| Molecular Formula | C8H14N2O4 |
| MDL Number | MFCD00008875 |
| Molecular Weight | 202.21 |
| MOL File | 2446-83-5.mol |
Chemical Properties
| Appearance | clear to slightly opalescent orange liquid |
| Melting point | 3-5 °C |
| Boiling point | 75 °C/0.25 mmHg (lit.) |
| density | 1.027 g/mL at 25 °C(lit.) |
| vapor pressure | 1.04 hPa (20 °C) |
| refractive index | n |
| Fp | 223 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Clear to slightly turbid yellow-orange to red |
| Water Solubility | insoluble |
| Sensitive | Light Sensitive |
| Detection Methods | GC,NMR |
| BRN | 1912326 |
| InChI | InChI=1S/C8H14N2O4/c1-5(2)13-7(11)9-10-8(12)14-6(3)4/h5-6H,1-4H3 |
| InChIKey | VVWRJUBEIPHGQF-UHFFFAOYSA-N |
| SMILES | N(C(OC(C)C)=O)=NC(OC(C)C)=O |
| CAS DataBase Reference | 2446-83-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H351-H411 |
| Precautionary statements | P202-P261-P273-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn,Xi,N,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 1 |
| F | 4.10-8 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29270000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT RE 2 STOT SE 3 |


