
40925-68-6
| Name | 2-Amino-4-bromophenol |
| CAS | 40925-68-6 |
| EINECS(EC#) | 627-173-0 |
| Molecular Formula | C6H6BrNO |
| MDL Number | MFCD00235171 |
| Molecular Weight | 188.02 |
| MOL File | 40925-68-6.mol |
Chemical Properties
| Melting point | 135-140°C |
| Boiling point | 282.8±25.0 °C(Predicted) |
| density | 1.768±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 9.19±0.18(Predicted) |
| color | White to Gray to Brown |
| BRN | 3236448 |
| InChI | InChI=1S/C6H6BrNO/c7-4-1-2-6(9)5(8)3-4/h1-3,9H,8H2 |
| InChIKey | JHRIPENGTGSNPJ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C=C1N |
| CAS DataBase Reference | 40925-68-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |

