3844-45-9
| Name | Erioglaucine disodium salt |
| CAS | 3844-45-9 |
| EINECS(EC#) | 223-339-8 |
| Molecular Formula | C37H34N2Na2O9S3 |
| MDL Number | MFCD00012141 |
| Molecular Weight | 792.85 |
| MOL File | 3844-45-9.mol |
Chemical Properties
| Appearance | reddish-violet powder or granules |
| Melting point | 283 °C (dec.)(lit.) |
| density | 0.65 |
| storage temp. | 2-8°C |
| solubility | water: soluble1mg/mL |
| Colour Index | 42090 |
| form | Fine Crystalline Powder |
| color | Dark purple |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | SOLUBLE |
| ε(extinction coefficient) | ≥10000 at 306-310nm in H2O ≥80000 at 627-631nm in H2O ≥9500 at 627-631nm in H2O |
| λmax | 406 nm, 625 nm |
| Merck | 14,1373 |
| Biological Applications | Treating coughing,sneezing,rhinorrhea,nasal obstruction,rhinitis; medical devices |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | HAIR DYEING COLORANT |
| InChIKey | SGHZXLIDFTYFHQ-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].CCN(Cc1cccc(c1)S([O-])(=O)=O)c2ccc(cc2)C(=C3\C=C/C(C=C3)=[N+](\CC)Cc4cccc(c4)S([O-])(=O)=O)\c5ccccc5S([O-])(=O)=O |
| LogP | -0.320 |
Safety Data
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H412 |
| Precautionary statements | P273 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | BQ4725000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 3844-45-9(Hazardous Substances Data) |
| Toxicity |