37247-10-2
| Name | Azure II |
| CAS | 37247-10-2 |
| EINECS(EC#) | 609-371-9 |
| Molecular Formula | C31H34Cl2N6S2 |
| MDL Number | MFCD00080716 |
| Molecular Weight | 625.68 |
| MOL File | 37247-10-2.mol |
Chemical Properties
| Appearance | dark green to black crystalline powder |
| Melting point | 205 °C |
| bulk density | 610kg/m3 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: 10 mg/mL |
| Colour Index | 52010/52015 |
| form | powder |
| color | Dark green |
| PH | 2.9 (10g/l, H2O, 20℃) |
| Water Solubility | Soluble in water |
| ε(extinction coefficient) | ≥1500 at 652-658nm in water at 0.003g/L ≥400 at 243-249nm in water at 0.003g/L ≥800 at 288-294nm in water at 0.003g/L |
| λmax | 657 nm |
| Merck | 6058 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | YOWZJZJLXUQHGF-UHFFFAOYSA-M |
| SMILES | [s+]1c2c(nc3c1cc(cc3)N(CC)CC)ccc(c2)N(CC)CC || [Cl-].[Cl-].CNc1ccc2N=C3C=C\C(C=C3Sc2c1)=[N+](\C)C.CN(C)c4ccc5N=C6C=C\C(C=C6Sc5c4)=[N+](\C)C |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 3204.13.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |