30748-47-1
| Name | 2-Amino-4-methyl-5-acetylthiazole |
| CAS | 30748-47-1 |
| EINECS(EC#) | 626-871-2 |
| Molecular Formula | C6H8N2OS |
| MDL Number | MFCD00051952 |
| Molecular Weight | 156.21 |
| MOL File | 30748-47-1.mol |
Chemical Properties
| Appearance | white to off-white powder |
| Melting point | 268-272 °C (dec.) (lit.) |
| Boiling point | 312.8±22.0 °C(Predicted) |
| density | 1.278±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| pka | 3.58±0.10(Predicted) |
| color | White to Orange to Green |
| Water Solubility | Insoluble |
| BRN | 127111 |
| InChI | InChI=1S/C6H8N2OS/c1-3-5(4(2)9)10-6(7)8-3/h1-2H3,(H2,7,8) |
| InChIKey | PKUKCASRNJIQNU-UHFFFAOYSA-N |
| SMILES | C(=O)(C1SC(N)=NC=1C)C |
| CAS DataBase Reference | 30748-47-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29341000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |