
1271-55-2
| Name | Acetylferrocene |
| CAS | 1271-55-2 |
| EINECS(EC#) | 215-043-2 |
| Molecular Formula | C12H12FeO 10* |
| MDL Number | MFCD00001432 |
| Molecular Weight | 228.07 |
| MOL File | 1271-55-2.mol |
Chemical Properties
| Appearance | orange crystalline powder |
| Melting point | 81-83 °C (lit.) |
| Boiling point | 160-163 °C (3.0004 mmHg) |
| density | >1 g/cm3 (20℃) |
| Fp | 160-163°C/4mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Needle-Like Crystalline Powder |
| color | Orange |
| Stability: | Stable. Incompatible with strong oxidizing agents, reducing agents, strong acids, strong bases. |
| Water Solubility | insoluble |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| InChI | InChI=1S/C7H7O.C5H5.Fe/c1-6(8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-5H,1H3;1-5H; |
| InChIKey | PHMAOJNZIFULOG-UHFFFAOYSA-N |
| SMILES | [C]1(C(=O)C)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,4,5,6,7,8,9,10,11,12| |
| CAS DataBase Reference | 1271-55-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetylferrocene(1271-55-2) |
| EPA Substance Registry System | 1271-55-2(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310 |
| Precautionary statements | P262-P264-P270-P280-P301+P310-P302+P352+P310 |
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | OB3700000 |
| F | 10 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29310095 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Oral |
| Safety Profile | |
| Toxicity |
