| Appearance |
white crystalline powder or granules |
| Melting point |
195°C |
| alpha |
10.2 º (c=1, H2O 22 ºC) |
| Boiling point |
400℃[at 101 325 Pa] |
| density |
1.677[at 20℃] |
| vapor pressure |
0.004Pa at 20℃ |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Sparingly soluble in water, freely soluble in boiling water. |
| form |
Crystals or Crystalline Powder |
| color |
White |
| Odor |
at 100.00?%. odorless |
| PH |
pH;6.0～8.0 |
| Stability: |
Stable. Incompatible with strong oxidizing agents. |
| biological source |
synthetic (organic) |
| Water Solubility |
3.3 g/100mL |
| Hydrolytic Sensitivity |
0: forms stable aqueous solutions |
| Merck |
14,1670 |
| Major Application |
pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions |
CHELATING
SKIN CONDITIONING - MISCELLANEOUS |
| Cosmetic Ingredient Review (CIR) |
Calcium gluconate (299-28-5) |
| InChI |
1S/2C6H12O7.Ca/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChIKey |
KYUVBRZSDFBLTH-OSQBQZLYSA-M |
| SMILES |
OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O[Ca]OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| LogP |
-5.31 at 20℃ |
| Uses |
Calcium Gluconate is a white crystalline granule or powder that
functions as a firming agent, formulation aid, sequestrant, and sta-
bilizer. at room temperature the anhydrous form has a solubility of
approximately 1 g in 30 ml of water, which improves in boiling
water to approximately 1 g in 5 ml of water. it also exists as calcium
gluconate (monohydrate). it is used as a source of calcium ions for
sodium alginate gels, and as a calcium fortifier in baked goods, pud-
dings, and dairy product analogs. it functions as a coagulation aid
in milk and instant pudding powders and as a means of masking the
bitter aftertaste of some artificial sweeteners.
|
| CAS DataBase Reference |
299-28-5(CAS DataBase Reference) |
| EPA Substance Registry System |
299-28-5(EPA Substance) |
