29490-19-5
| Name | 2-Mercapto-5-methyl-1,3,4-thiadiazole |
| CAS | 29490-19-5 |
| EINECS(EC#) | 249-667-1 |
| Molecular Formula | C3H4N2S2 |
| MDL Number | MFCD00038349 |
| Molecular Weight | 132.21 |
| MOL File | 29490-19-5.mol |
Chemical Properties
| Appearance | white crystal powder |
| Melting point | 185-188 °C |
| Boiling point | 182.9±23.0 °C(Predicted) |
| density | 1.373 (estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | chloroform: soluble10mg/mL, clear to very slightly hazy, colorless |
| form | solid |
| pka | 6.49±0.40(Predicted) |
| color | White to Off-White |
| Water Solubility | 2 g/100 mL |
| Detection Methods | HPLC,NMR |
| BRN | 606663 |
| InChI | InChI=1S/C3H4N2S2/c1-2-4-5-3(6)7-2/h1H3,(H,5,6) |
| InChIKey | FPVUWZFFEGYCGB-UHFFFAOYSA-N |
| SMILES | S1C(C)=NNC1=S |
| CAS DataBase Reference | 29490-19-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,4-Thiadiazole-2(3H)-thione, 5-methyl-(29490-19-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HS Code | 29349900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |