
280566-45-2
| Name | 2-Chloro-6-trifluoromethylnicotinic acid |
| CAS | 280566-45-2 |
| EINECS(EC#) | 631-076-9 |
| Molecular Formula | C7H3ClF3NO2 |
| MDL Number | MFCD01862658 |
| Molecular Weight | 225.55 |
| MOL File | 280566-45-2.mol |
Chemical Properties
| Melting point | 120 °C |
| Boiling point | 271.3±40.0 °C(Predicted) |
| density | 1.603±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 1.42±0.28(Predicted) |
| color | White to Light yellow |
| Detection Methods | HPLC |
| InChI | InChI=1S/C7H3ClF3NO2/c8-5-3(6(13)14)1-2-4(12-5)7(9,10)11/h1-2H,(H,13,14) |
| InChIKey | DXRBTBMFFGEVCX-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C(F)(F)F)=CC=C1C(O)=O |
| CAS DataBase Reference | 280566-45-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P301+P310-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
