
27387-31-1
| Name | 1,2,3,4-Tetrahydro-9-methylcarbazol-4-one |
| CAS | 27387-31-1 |
| EINECS(EC#) | 608-096-1 |
| Molecular Formula | C13H13NO |
| MDL Number | MFCD00173748 |
| Molecular Weight | 199.25 |
| MOL File | 27387-31-1.mol |
Chemical Properties
| Melting point | 199.0 to 203.0 °C |
| Boiling point | 383.5±11.0 °C(Predicted) |
| density | 1.21±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | neat |
| color | White to Light yellow |
| BRN | 153862 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H13NO/c1-14-10-6-3-2-5-9(10)13-11(14)7-4-8-12(13)15/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | HHJUJCWZKJMCLC-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=CC=C2)C2=C1CCCC2=O |
| CAS DataBase Reference | 27387-31-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H412 |
| Precautionary statements | P264-P270-P273-P301+P310-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 3 |
