2611-82-7
| Name | Acid Red 18 |
| CAS | 2611-82-7 |
| EINECS(EC#) | 220-036-2 |
| Molecular Formula | C20H11N2Na3O10S3 |
| MDL Number | MFCD00004084 |
| Molecular Weight | 604.47 |
| MOL File | 2611-82-7.mol |
Chemical Properties
| Appearance | Deep red powder |
| Melting point | >300oC |
| density | 1.772[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly, Heated), Water (Slightly) |
| Colour Index | 16255 |
| form | Powder |
| color | Bordeaux to brown |
| Water Solubility | 305.21g/L at 20℃ |
| λmax | 350 nm (2nd) 506 nm |
| BRN | 4122340 |
| Stability: | Hygroscopic |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChIKey | MSUZYPTYNUUBFH-ZPZFBZIMSA-N |
| SMILES | N(/C1=C(C=CC2=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C12)O)=N\C1=CC=C(S(O)(=O)=O)C2=CC=CC=C12.[NaH] |
| LogP | -2.267 at 20℃ |
| EPA Substance Registry System | 1,3-Naphthalenedisulfonic acid, 7-hydroxy-8-[(4-sulfo-1-naphthalenyl) azo]-, trisodium salt(2611-82-7) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | QJ6530000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 32041200 |
| Storage Class | 11 - Combustible Solids |
| Safety Profile | |
| Hazardous Substances Data | 2611-82-7(Hazardous Substances Data) |
| Toxicity |