532-02-5
| Name | Sodium 2-naphthalenesulfonate |
| CAS | 532-02-5 |
| EINECS(EC#) | 208-523-8 |
| Molecular Formula | C10H7NaO3S |
| MDL Number | MFCD00064186 |
| Molecular Weight | 230.22 |
| MOL File | 532-02-5.mol |
Chemical Properties
| Appearance | white to pale grey powder |
| Melting point | 172-173 °C |
| Boiling point | 391.58℃ |
| density | 0.4g/cm3 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| form | Powder |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| λmax | λ: 380 nm Amax: 0.1 λ: 390 nm Amax: 0.05 λ: 400 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 3659024 |
| Cosmetics Ingredients Functions | SURFACTANT - CLEANSING SURFACTANT - HYDROTROPE |
| InChI | InChI=1S/C10H8O3S.Na/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;/h1-7H,(H,11,12,13);/q;+1/p-1 |
| InChIKey | YWPOLRBWRRKLMW-UHFFFAOYSA-M |
| SMILES | C12C=CC=CC1=CC=C(S([O-])(=O)=O)C=2.[Na+] |
| LogP | 0.01 |
| CAS DataBase Reference | 532-02-5(CAS DataBase Reference) |
| EPA Substance Registry System | 532-02-5(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | QK3678000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29041000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
| Hazardous Substances Data | 532-02-5(Hazardous Substances Data) |