5413-75-2
| Name | Acid Red 73 |
| CAS | 5413-75-2 |
| EINECS(EC#) | 226-502-1 |
| Molecular Formula | C22H14N4Na2O7S2 |
| MDL Number | MFCD00003907 |
| Molecular Weight | 556.48 |
| MOL File | 5413-75-2.mol |
Chemical Properties
| Colour Index | 27290 |
| form | neat |
| color | Orange to Amber to Dark red |
| Water Solubility | Soluble in water |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChIKey | LEYOEXMOLVBFPD-RVTJCSDESA-N |
| SMILES | N(/C1=C(C=CC2=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C12)O)=N\C1C=CC(/N=N/C2C=CC=CC=2)=CC=1.[NaH] |
| CAS DataBase Reference | 5413-75-2(CAS DataBase Reference) |
| EPA Substance Registry System | 5413-75-2(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 32041990 |
| Storage Class | 11 - Combustible Solids |