
24279-39-8
| Name | 4-Amino-3,5-dichlorobenzotrifluoride |
| CAS | 24279-39-8 |
| EINECS(EC#) | 416-430-0 |
| Molecular Formula | C7H4Cl2F3N |
| MDL Number | MFCD00052918 |
| Molecular Weight | 230.01 |
| MOL File | 24279-39-8.mol |
Chemical Properties
| Appearance | light yellow low melting crystalline mass or |
| Melting point | 34-36 °C(lit.) |
| Boiling point | 60-62 °C1 mm Hg(lit.) |
| density | 1.532 g/mL at 25 °C(lit.) |
| Fp | 190 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | -1.13±0.10(Predicted) |
| color | White to Orange to Green |
| Specific Gravity | 1.532 |
| Detection Methods | GC |
| BRN | 2838819 |
| InChI | InChI=1S/C7H4Cl2F3N/c8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 |
| InChIKey | ITNMAZSPBLRJLU-UHFFFAOYSA-N |
| SMILES | C1(N)=C(Cl)C=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 24279-39-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H332-H400-H302+H332-H315-H317-H410 |
| Precautionary statements | P280g-P301+P312a-P304+P340-P321-P501a-P273-P280-P501-P261-P264-P270-P271-P272-P301+P312+P330-P302+P352+P333+P313+P363-P304+P340+P312-P391 |
| Hazard Codes | Xn,N,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| REACH Registrations | Active |
| HazardClass | 9 |
| HazardClass | TOXIC |
| PackingGroup | III |
| HS Code | 29214320 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |

